C16H11ClN2O3S — CID 84564796
2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]-4-chlorophenol (PubChem CID 84564796) has the molecular formula C16H11ClN2O3S and a molecular weight of 346.80 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]-4-chlorophenol.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 84564796 |
| Molecular Formula | C16H11ClN2O3S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylamino)-1,3-thiazol-4-yl]-4-chlorophenol |
| SMILES | Oc1ccc(Cl)cc1-c1csc(Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C16H11ClN2O3S/c17-9-1-3-13(20)11(5-9)12-7-23-16(19-12)18-10-2-4-14-15(6-10)22-8-21-14/h1-7,20H,8H2,(H,18,19) |
| InChIKey | NRUSOXRVFPABET-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |