C20H17ClN2O3 — CID 137307190
2-[4-(1,3-benzodioxol-5-yl)-6-(ethylamino)-2-pyridinyl]-4-chlorophenol (PubChem CID 137307190) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-6-(ethylamino)-2-pyridinyl]-4-chlorophenol.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-6-(ethylamino)-2-pyridinyl]-4-chlorophenol |
|---|---|
| PubChem CID | 137307190 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-6-(ethylamino)-2-pyridinyl]-4-chlorophenol |
| SMILES | CCNc1cc(-c2ccc3c(c2)OCO3)cc(-c2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C20H17ClN2O3/c1-2-22-20-9-13(12-3-6-18-19(8-12)26-11-25-18)7-16(23-20)15-10-14(21)4-5-17(15)24/h3-10,24H,2,11H2,1H3,(H,22,23) |
| InChIKey | DYFBBDKUZJPCIH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |