C13H10O4 — CID 141023999
4-(1,3-benzodioxol-5-yl)benzene-1,2-diol (PubChem CID 141023999) has the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)benzene-1,2-diol.
| Compound Name | 4-(1,3-benzodioxol-5-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 141023999 |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(-c2ccc3c(c2)OCO3)cc1O |
| InChI | InChI=1S/C13H10O4/c14-10-3-1-8(5-11(10)15)9-2-4-12-13(6-9)17-7-16-12/h1-6,14-15H,7H2 |
| InChIKey | YWWGEVJXZRMMFB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|