C13H9NO4 — CID 53223206
4-(1,3-benzodioxol-5-yl)pyridine-2-carboxylic acid (PubChem CID 53223206) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)pyridine-2-carboxylic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 53223206 |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc3c(c2)OCO3)ccn1 |
| InChI | InChI=1S/C13H9NO4/c15-13(16)10-5-9(3-4-14-10)8-1-2-11-12(6-8)18-7-17-11/h1-6H,7H2,(H,15,16) |
| InChIKey | OZJDIHLFJJVXJA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |