C13H14N2O4 — CID 161486189
4-aminobenzene-1,2-diol;1,3-benzodioxol-5-amine (PubChem CID 161486189) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-aminobenzene-1,2-diol;1,3-benzodioxol-5-amine.
| Compound Name | 4-aminobenzene-1,2-diol;1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 161486189 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-aminobenzene-1,2-diol;1,3-benzodioxol-5-amine |
| SMILES | Nc1ccc(O)c(O)c1.Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H7NO2.C6H7NO2/c8-5-1-2-6-7(3-5)10-4-9-6;7-4-1-2-5(8)6(9)3-4/h1-3H,4,8H2;1-3,8-9H,7H2 |
| InChIKey | WEZUCSGKJFKFKP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|