C16H11NO5 — CID 142651080
7-amino-2-(1,3-benzodioxol-5-yl)-3-hydroxychromen-4-one (PubChem CID 142651080) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 7-amino-2-(1,3-benzodioxol-5-yl)-3-hydroxychromen-4-one.
| Compound Name | 7-amino-2-(1,3-benzodioxol-5-yl)-3-hydroxychromen-4-one |
|---|---|
| PubChem CID | 142651080 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 7-amino-2-(1,3-benzodioxol-5-yl)-3-hydroxychromen-4-one |
| SMILES | Nc1ccc2c(=O)c(O)c(-c3ccc4c(c3)OCO4)oc2c1 |
| InChI | InChI=1S/C16H11NO5/c17-9-2-3-10-12(6-9)22-16(15(19)14(10)18)8-1-4-11-13(5-8)21-7-20-11/h1-6,19H,7,17H2 |
| InChIKey | CAULOQWPWQJGCU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|