About 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea
1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea (PubChem CID 18372844) has the molecular formula C23H14Cl2N2O6
and a molecular weight of 485.28 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea |
| PubChem CID | 18372844 |
| Molecular Formula | C23H14Cl2N2O6 |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc2oc(-c3ccc4c(c3)OCO4)c(O)c(=O)c2c1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H14Cl2N2O6/c24-12-2-4-16(15(25)8-12)27-23(30)26-13-3-6-17-14(9-13)20(28)21(29)22(33-17)11-1-5-18-19(7-11)32-10-31-18/h1-9,29H,10H2,(H2,26,27,30) |
| InChIKey | SUSNZJQCMQOOKF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea?
The IUPAC name of 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea (CID 18372844) is 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea.
What is the SMILES notation for 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea?
The canonical SMILES for 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea is O=C(Nc1ccc2oc(-c3ccc4c(c3)OCO4)c(O)c(=O)c2c1)Nc1ccc(Cl)cc1Cl.
What is the InChIKey of 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea?
The InChIKey is SUSNZJQCMQOOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14Cl2N2O6/c24-12-2-4-16(15(25)8-12)27-23(30)26-13-3-6-17-14(9-13)20(28)21(29)22(33-17)11-1-5-18-19(7-11)32-10-31-18/h1-9,29H,10H2,(H2,26,27,30).
What are the key properties of 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea?
1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea has a molecular weight of 485.28 g/mol, XLogP of 5.85, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-benzodioxol-5-yl)-3-hydroxy-4-oxochromen-6-yl]-3-(2,4-dichlorophenyl)urea is sourced from PubChem (CID 18372844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).