C18H16Cl2N2O4 — CID 108952650
N'-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]propanediamide (PubChem CID 108952650) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]propanediamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]propanediamide |
|---|---|
| PubChem CID | 108952650 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[2-(2,4-dichlorophenyl)ethyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1ccc2c(c1)OCO2)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N2O4/c19-12-2-1-11(14(20)7-12)5-6-21-17(23)9-18(24)22-13-3-4-15-16(8-13)26-10-25-15/h1-4,7-8H,5-6,9-10H2,(H,21,23)(H,22,24) |
| InChIKey | PKDYUJVXZRSLMY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|