C15H15Cl2N3O3 — CID 108952659
N-[2-(2,4-dichlorophenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide (PubChem CID 108952659) has the molecular formula C15H15Cl2N3O3 and a molecular weight of 356.21 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide |
|---|---|
| PubChem CID | 108952659 |
| Molecular Formula | C15H15Cl2N3O3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide |
| SMILES | Cc1cc(NC(=O)CC(=O)NCCc2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C15H15Cl2N3O3/c1-9-6-13(20-23-9)19-15(22)8-14(21)18-5-4-10-2-3-11(16)7-12(10)17/h2-3,6-7H,4-5,8H2,1H3,(H,18,21)(H,19,20,22) |
| InChIKey | KVPIYTGOLQYYOO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|