C17H15Cl2FN2O2 — CID 108952631
N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-fluorophenyl)propanediamide (PubChem CID 108952631) has the molecular formula C17H15Cl2FN2O2 and a molecular weight of 369.22 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-fluorophenyl)propanediamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 108952631 |
| Molecular Formula | C17H15Cl2FN2O2 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-N'-(2-fluorophenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1F)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2FN2O2/c18-12-6-5-11(13(19)9-12)7-8-21-16(23)10-17(24)22-15-4-2-1-3-14(15)20/h1-6,9H,7-8,10H2,(H,21,23)(H,22,24) |
| InChIKey | PQBFNZCARSWZJL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|