C16H14Cl2FNO — CID 2713418
N-[2-(2,4-dichlorophenyl)ethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 2713418) has the molecular formula C16H14Cl2FNO and a molecular weight of 326.20 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2713418 |
| Molecular Formula | C16H14Cl2FNO |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2FNO/c17-13-6-5-11(14(18)10-13)7-8-20-16(21)9-12-3-1-2-4-15(12)19/h1-6,10H,7-9H2,(H,20,21) |
| InChIKey | RUGCVWNTJONWMI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |