C15H13Cl2NO3 — CID 103890168
N-[2-(2,4-dichlorophenyl)ethyl]-2,6-dihydroxybenzamide (PubChem CID 103890168) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2,6-dihydroxybenzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 103890168 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,6-dihydroxybenzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1c(O)cccc1O |
| InChI | InChI=1S/C15H13Cl2NO3/c16-10-5-4-9(11(17)8-10)6-7-18-15(21)14-12(19)2-1-3-13(14)20/h1-5,8,19-20H,6-7H2,(H,18,21) |
| InChIKey | FGJMHUTXMKCMJC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |