C15H13Cl3N2O — CID 29286863
5-amino-2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 29286863) has the molecular formula C15H13Cl3N2O and a molecular weight of 343.64 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 5-amino-2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 29286863 |
| Molecular Formula | C15H13Cl3N2O |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 5-amino-2-chloro-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | Nc1ccc(Cl)c(C(=O)NCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl3N2O/c16-10-2-1-9(14(18)7-10)5-6-20-15(21)12-8-11(19)3-4-13(12)17/h1-4,7-8H,5-6,19H2,(H,20,21) |
| InChIKey | WIZSHFMRNNCPLY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|