C15H14Cl2N2O2 — CID 60988922
5-amino-2-[2-(2,4-dichlorophenyl)ethylamino]benzoic acid (PubChem CID 60988922) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 5-amino-2-[2-(2,4-dichlorophenyl)ethylamino]benzoic acid.
| Compound Name | 5-amino-2-[2-(2,4-dichlorophenyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 60988922 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 5-amino-2-[2-(2,4-dichlorophenyl)ethylamino]benzoic acid |
| SMILES | Nc1ccc(NCCc2ccc(Cl)cc2Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-10-2-1-9(13(17)7-10)5-6-19-14-4-3-11(18)8-12(14)15(20)21/h1-4,7-8,19H,5-6,18H2,(H,20,21) |
| InChIKey | OIWABFGSHMCVGT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|