C12H14N4O3 — CID 106422577
5-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid (PubChem CID 106422577) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 5-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid.
| Compound Name | 5-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106422577 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-amino-2-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]benzoic acid |
| SMILES | Cc1nc(CCNc2ccc(N)cc2C(=O)O)no1 |
| InChI | InChI=1S/C12H14N4O3/c1-7-15-11(16-19-7)4-5-14-10-3-2-8(13)6-9(10)12(17)18/h2-3,6,14H,4-5,13H2,1H3,(H,17,18) |
| InChIKey | IAPNQZLUSNREBL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|