C10H14N2O2S — CID 63961847
5-amino-2-(2-methylsulfanylethylamino)benzoic acid (PubChem CID 63961847) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 5-amino-2-(2-methylsulfanylethylamino)benzoic acid.
| Compound Name | 5-amino-2-(2-methylsulfanylethylamino)benzoic acid |
|---|---|
| PubChem CID | 63961847 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-amino-2-(2-methylsulfanylethylamino)benzoic acid |
| SMILES | CSCCNc1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C10H14N2O2S/c1-15-5-4-12-9-3-2-7(11)6-8(9)10(13)14/h2-3,6,12H,4-5,11H2,1H3,(H,13,14) |
| InChIKey | GVBPRHJXTYGWKZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|