C12H19N3OS — CID 113487250
4-amino-2-(4-methylsulfanylbutylamino)benzamide (PubChem CID 113487250) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 4-amino-2-(4-methylsulfanylbutylamino)benzamide.
| Compound Name | 4-amino-2-(4-methylsulfanylbutylamino)benzamide |
|---|---|
| PubChem CID | 113487250 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-amino-2-(4-methylsulfanylbutylamino)benzamide |
| SMILES | CSCCCCNc1cc(N)ccc1C(N)=O |
| InChI | InChI=1S/C12H19N3OS/c1-17-7-3-2-6-15-11-8-9(13)4-5-10(11)12(14)16/h4-5,8,15H,2-3,6-7,13H2,1H3,(H2,14,16) |
| InChIKey | BOAPAGCFQCCEFY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|