C9H11F2N3O — CID 115405473
4-amino-2-(2,2-difluoroethylamino)benzamide (PubChem CID 115405473) has the molecular formula C9H11F2N3O and a molecular weight of 215.20 g/mol. Its IUPAC name is 4-amino-2-(2,2-difluoroethylamino)benzamide.
| Compound Name | 4-amino-2-(2,2-difluoroethylamino)benzamide |
|---|---|
| PubChem CID | 115405473 |
| Molecular Formula | C9H11F2N3O |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-amino-2-(2,2-difluoroethylamino)benzamide |
| SMILES | NC(=O)c1ccc(N)cc1NCC(F)F |
| InChI | InChI=1S/C9H11F2N3O/c10-8(11)4-14-7-3-5(12)1-2-6(7)9(13)15/h1-3,8,14H,4,12H2,(H2,13,15) |
| InChIKey | LRPLCGXEWILAEY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|