C11H13N5O2 — CID 114183117
4-amino-2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide (PubChem CID 114183117) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-amino-2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide.
| Compound Name | 4-amino-2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 114183117 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-amino-2-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide |
| SMILES | NC(=O)c1ccc(N)cc1NCCc1ncno1 |
| InChI | InChI=1S/C11H13N5O2/c12-7-1-2-8(11(13)17)9(5-7)14-4-3-10-15-6-16-18-10/h1-2,5-6,14H,3-4,12H2,(H2,13,17) |
| InChIKey | XLCGIXVOZPDSQT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|