C11H11N5O4 — CID 106403735
4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide (PubChem CID 106403735) has the molecular formula C11H11N5O4 and a molecular weight of 277.24 g/mol. Its IUPAC name is 4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide.
| Compound Name | 4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 106403735 |
| Molecular Formula | C11H11N5O4 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-nitro-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzamide |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c(NCCc2ncno2)c1 |
| InChI | InChI=1S/C11H11N5O4/c12-11(17)7-1-2-9(16(18)19)8(5-7)13-4-3-10-14-6-15-20-10/h1-2,5-6,13H,3-4H2,(H2,12,17) |
| InChIKey | ZEZJZPIZYZLYPA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|