C10H14N4O5S — CID 82995123
4-nitro-3-(3-sulfamoylpropylamino)benzamide (PubChem CID 82995123) has the molecular formula C10H14N4O5S and a molecular weight of 302.31 g/mol. Its IUPAC name is 4-nitro-3-(3-sulfamoylpropylamino)benzamide.
| Compound Name | 4-nitro-3-(3-sulfamoylpropylamino)benzamide |
|---|---|
| PubChem CID | 82995123 |
| Molecular Formula | C10H14N4O5S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-nitro-3-(3-sulfamoylpropylamino)benzamide |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c(NCCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H14N4O5S/c11-10(15)7-2-3-9(14(16)17)8(6-7)13-4-1-5-20(12,18)19/h2-3,6,13H,1,4-5H2,(H2,11,15)(H2,12,18,19) |
| InChIKey | QMHAAQDKEFQZCO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 158.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|