C11H12F3N3O4 — CID 82991923
4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide (PubChem CID 82991923) has the molecular formula C11H12F3N3O4 and a molecular weight of 307.23 g/mol. Its IUPAC name is 4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide.
| Compound Name | 4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide |
|---|---|
| PubChem CID | 82991923 |
| Molecular Formula | C11H12F3N3O4 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-nitro-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzamide |
| SMILES | NC(=O)c1ccc([N+](=O)[O-])c(NCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3N3O4/c12-11(13,14)6-21-4-3-16-8-5-7(10(15)18)1-2-9(8)17(19)20/h1-2,5,16H,3-4,6H2,(H2,15,18) |
| InChIKey | FIWFIBGMMLPIPB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|