C10H10F3IN2O3 — CID 60971159
4-iodo-2-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline (PubChem CID 60971159) has the molecular formula C10H10F3IN2O3 and a molecular weight of 390.10 g/mol. Its IUPAC name is 4-iodo-2-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline.
| Compound Name | 4-iodo-2-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
|---|---|
| PubChem CID | 60971159 |
| Molecular Formula | C10H10F3IN2O3 |
| Molecular Weight | 390.10 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 4-iodo-2-nitro-N-[2-(2,2,2-trifluoroethoxy)ethyl]aniline |
| SMILES | O=[N+]([O-])c1cc(I)ccc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H10F3IN2O3/c11-10(12,13)6-19-4-3-15-8-2-1-7(14)5-9(8)16(17)18/h1-2,5,15H,3-4,6H2 |
| InChIKey | RKALUFHJYPUMHA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|