C13H16N4O3 — CID 106407389
ethyl 4-amino-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoate (PubChem CID 106407389) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is ethyl 4-amino-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoate.
| Compound Name | ethyl 4-amino-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 106407389 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | ethyl 4-amino-3-[2-(1,2,4-oxadiazol-5-yl)ethylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(NCCc2ncno2)c1 |
| InChI | InChI=1S/C13H16N4O3/c1-2-19-13(18)9-3-4-10(14)11(7-9)15-6-5-12-16-8-17-20-12/h3-4,7-8,15H,2,5-6,14H2,1H3 |
| InChIKey | OKEGLVUESHUYGI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|