C12H14N4O2 — CID 106391499
4-amino-3-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzamide (PubChem CID 106391499) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-amino-3-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzamide.
| Compound Name | 4-amino-3-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 106391499 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-amino-3-methyl-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]benzamide |
| SMILES | Cc1cc(C(=O)NCCc2ncno2)ccc1N |
| InChI | InChI=1S/C12H14N4O2/c1-8-6-9(2-3-10(8)13)12(17)14-5-4-11-15-7-16-18-11/h2-3,6-7H,4-5,13H2,1H3,(H,14,17) |
| InChIKey | RSOQNIRBHJCCGJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|