C13H17F3N2O3 — CID 82777038
ethyl 4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate (PubChem CID 82777038) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is ethyl 4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate.
| Compound Name | ethyl 4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate |
|---|---|
| PubChem CID | 82777038 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethyl 4-amino-3-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(NCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O3/c1-2-21-12(19)9-3-4-10(17)11(7-9)18-5-6-20-8-13(14,15)16/h3-4,7,18H,2,5-6,8,17H2,1H3 |
| InChIKey | DEPOHEIMBMJQSB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|