C12H14F3NO3 — CID 63828854
3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoic acid (PubChem CID 63828854) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is 3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoic acid.
| Compound Name | 3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 63828854 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO3/c1-8-6-9(11(17)18)2-3-10(8)16-4-5-19-7-12(13,14)15/h2-3,6,16H,4-5,7H2,1H3,(H,17,18) |
| InChIKey | GZGYUAUFQKOCSU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|