C10H11F3N2O3 — CID 115490932
5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid (PubChem CID 115490932) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115490932 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCCOCC(F)(F)F)cn1 |
| InChI | InChI=1S/C10H11F3N2O3/c11-10(12,13)6-18-4-3-14-7-1-2-8(9(16)17)15-5-7/h1-2,5,14H,3-4,6H2,(H,16,17) |
| InChIKey | SNWYNPIGXBFNQK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|