C9H12N2O4S — CID 115490610
5-(2-methylsulfonylethylamino)pyridine-2-carboxylic acid (PubChem CID 115490610) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 5-(2-methylsulfonylethylamino)pyridine-2-carboxylic acid.
| Compound Name | 5-(2-methylsulfonylethylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115490610 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-(2-methylsulfonylethylamino)pyridine-2-carboxylic acid |
| SMILES | CS(=O)(=O)CCNc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C9H12N2O4S/c1-16(14,15)5-4-10-7-2-3-8(9(12)13)11-6-7/h2-3,6,10H,4-5H2,1H3,(H,12,13) |
| InChIKey | KZYLIDLUVXXMMK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |