C8H9N3O3 — CID 104638701
5-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid (PubChem CID 104638701) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 5-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104638701 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 5-[(2-amino-2-oxoethyl)amino]pyridine-2-carboxylic acid |
| SMILES | NC(=O)CNc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C8H9N3O3/c9-7(12)4-10-5-1-2-6(8(13)14)11-3-5/h1-3,10H,4H2,(H2,9,12)(H,13,14) |
| InChIKey | YYFLVDOITWIPKD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |