C6H7N3O4S — CID 114958996
5-(sulfamoylamino)pyridine-2-carboxylic acid (PubChem CID 114958996) has the molecular formula C6H7N3O4S and a molecular weight of 217.21 g/mol. Its IUPAC name is 5-(sulfamoylamino)pyridine-2-carboxylic acid.
| Compound Name | 5-(sulfamoylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114958996 |
| Molecular Formula | C6H7N3O4S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 5-(sulfamoylamino)pyridine-2-carboxylic acid |
| SMILES | NS(=O)(=O)Nc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C6H7N3O4S/c7-14(12,13)9-4-1-2-5(6(10)11)8-3-4/h1-3,9H,(H,10,11)(H2,7,12,13) |
| InChIKey | HATYNPRJDUBNJC-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |