5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid

C8H11N3O2 — CID 83024404

IUPAC5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid
SMILESCN(C)Nc1ccc(C(=O)O)nc1
InChIInChI=1S/C8H11N3O2/c1-11(2)10-6-3-4-7(8(12)13)9-5-6/h3-5,10H,1-2H3,(H,12,13)
InChIKeyBFFLHSIQIZEMHE-UHFFFAOYSA-N
MW181.19 g/mol
LogP0.67
Rot. Bonds3

About 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid

5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid (PubChem CID 83024404) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid
PubChem CID83024404
Molecular FormulaC8H11N3O2
Molecular Weight181.19 g/mol
Exact Mass181.09
IUPAC Name5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid
SMILESCN(C)Nc1ccc(C(=O)O)nc1
InChIInChI=1S/C8H11N3O2/c1-11(2)10-6-3-4-7(8(12)13)9-5-6/h3-5,10H,1-2H3,(H,12,13)
InChIKeyBFFLHSIQIZEMHE-UHFFFAOYSA-N
XLogP0.67
TPSA65.46 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 50.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid?
The IUPAC name of 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid (CID 83024404) is 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid?
The canonical SMILES for 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid is CN(C)Nc1ccc(C(=O)O)nc1.
What is the InChIKey of 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid?
The InChIKey is BFFLHSIQIZEMHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-11(2)10-6-3-4-7(8(12)13)9-5-6/h3-5,10H,1-2H3,(H,12,13).
What are the key properties of 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid?
5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid has a molecular weight of 181.19 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylhydrazinyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 83024404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).