C10H14N2O3 — CID 83186758
5-(4-hydroxybutan-2-ylamino)pyridine-2-carboxylic acid (PubChem CID 83186758) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-(4-hydroxybutan-2-ylamino)pyridine-2-carboxylic acid.
| Compound Name | 5-(4-hydroxybutan-2-ylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 83186758 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-(4-hydroxybutan-2-ylamino)pyridine-2-carboxylic acid |
| SMILES | CC(CCO)Nc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C10H14N2O3/c1-7(4-5-13)12-8-2-3-9(10(14)15)11-6-8/h2-3,6-7,12-13H,4-5H2,1H3,(H,14,15) |
| InChIKey | DUYWNQDTCRSROR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |