C9H13N3O4S — CID 115490708
5-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid (PubChem CID 115490708) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is 5-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid.
| Compound Name | 5-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115490708 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid |
| SMILES | NS(=O)(=O)CCCNc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C9H13N3O4S/c10-17(15,16)5-1-4-11-7-2-3-8(9(13)14)12-6-7/h2-3,6,11H,1,4-5H2,(H,13,14)(H2,10,15,16) |
| InChIKey | LQFRDAZATLHDCX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|