C9H14N4O4S — CID 114406222
5-amino-6-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid (PubChem CID 114406222) has the molecular formula C9H14N4O4S and a molecular weight of 274.30 g/mol. Its IUPAC name is 5-amino-6-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid.
| Compound Name | 5-amino-6-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114406222 |
| Molecular Formula | C9H14N4O4S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-amino-6-(3-sulfamoylpropylamino)pyridine-2-carboxylic acid |
| SMILES | Nc1ccc(C(=O)O)nc1NCCCS(N)(=O)=O |
| InChI | InChI=1S/C9H14N4O4S/c10-6-2-3-7(9(14)15)13-8(6)12-4-1-5-18(11,16)17/h2-3H,1,4-5,10H2,(H,12,13)(H,14,15)(H2,11,16,17) |
| InChIKey | SSESFFPGTWBION-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|