C11H18N4O2 — CID 114406169
5-amino-6-(4-methoxybutylamino)pyridine-2-carboxamide (PubChem CID 114406169) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-amino-6-(4-methoxybutylamino)pyridine-2-carboxamide.
| Compound Name | 5-amino-6-(4-methoxybutylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114406169 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 5-amino-6-(4-methoxybutylamino)pyridine-2-carboxamide |
| SMILES | COCCCCNc1nc(C(N)=O)ccc1N |
| InChI | InChI=1S/C11H18N4O2/c1-17-7-3-2-6-14-11-8(12)4-5-9(15-11)10(13)16/h4-5H,2-3,6-7,12H2,1H3,(H2,13,16)(H,14,15) |
| InChIKey | CWEUQRJPFORNQV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|