C14H24N6O4 — CID 58462499
3,6-bis(3-methoxypropylamino)pyrazine-2,5-dicarboxamide (PubChem CID 58462499) has the molecular formula C14H24N6O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3,6-bis(3-methoxypropylamino)pyrazine-2,5-dicarboxamide.
| Compound Name | 3,6-bis(3-methoxypropylamino)pyrazine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 58462499 |
| Molecular Formula | C14H24N6O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3,6-bis(3-methoxypropylamino)pyrazine-2,5-dicarboxamide |
| SMILES | COCCCNc1nc(C(N)=O)c(NCCCOC)nc1C(N)=O |
| InChI | InChI=1S/C14H24N6O4/c1-23-7-3-5-17-13-9(11(15)21)20-14(10(19-13)12(16)22)18-6-4-8-24-2/h3-8H2,1-2H3,(H2,15,21)(H2,16,22)(H,17,19)(H,18,20) |
| InChIKey | PVWAMTNUZLFXLT-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|