C16H22N6O2 — CID 19144248
N-[4-[[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 19144248) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[4-[[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 19144248 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-[4-[[5-amino-6-(3-methoxypropylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | COCCCNc1ncnc(Nc2ccc(NC(C)=O)cc2)c1N |
| InChI | InChI=1S/C16H22N6O2/c1-11(23)21-12-4-6-13(7-5-12)22-16-14(17)15(19-10-20-16)18-8-3-9-24-2/h4-7,10H,3,8-9,17H2,1-2H3,(H,21,23)(H2,18,19,20,22) |
| InChIKey | XJAUITQUTLZMKE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|