C14H17Cl2N5O — CID 22546817
4-N-(3,4-dichlorophenyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine (PubChem CID 22546817) has the molecular formula C14H17Cl2N5O and a molecular weight of 342.23 g/mol. Its IUPAC name is 4-N-(3,4-dichlorophenyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(3,4-dichlorophenyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22546817 |
| Molecular Formula | C14H17Cl2N5O |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 4-N-(3,4-dichlorophenyl)-6-N-(3-methoxypropyl)pyrimidine-4,5,6-triamine |
| SMILES | COCCCNc1ncnc(Nc2ccc(Cl)c(Cl)c2)c1N |
| InChI | InChI=1S/C14H17Cl2N5O/c1-22-6-2-5-18-13-12(17)14(20-8-19-13)21-9-3-4-10(15)11(16)7-9/h3-4,7-8H,2,5-6,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | UBMSTEYPEGIBSH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|