C18H18ClN5 — CID 22546566
6-N-benzyl-4-N-(3-chloro-4-methylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22546566) has the molecular formula C18H18ClN5 and a molecular weight of 339.83 g/mol. Its IUPAC name is 6-N-benzyl-4-N-(3-chloro-4-methylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-benzyl-4-N-(3-chloro-4-methylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22546566 |
| Molecular Formula | C18H18ClN5 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 6-N-benzyl-4-N-(3-chloro-4-methylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | Cc1ccc(Nc2ncnc(NCc3ccccc3)c2N)cc1Cl |
| InChI | InChI=1S/C18H18ClN5/c1-12-7-8-14(9-15(12)19)24-18-16(20)17(22-11-23-18)21-10-13-5-3-2-4-6-13/h2-9,11H,10,20H2,1H3,(H2,21,22,23,24) |
| InChIKey | CNCWAPLSHUGQND-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |