C17H15Cl2N5 — CID 22544898
6-N-benzyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 22544898) has the molecular formula C17H15Cl2N5 and a molecular weight of 360.25 g/mol. Its IUPAC name is 6-N-benzyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-benzyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22544898 |
| Molecular Formula | C17H15Cl2N5 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 6-N-benzyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCc2ccccc2)ncnc1Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N5/c18-12-6-13(19)8-14(7-12)24-17-15(20)16(22-10-23-17)21-9-11-4-2-1-3-5-11/h1-8,10H,9,20H2,(H2,21,22,23,24) |
| InChIKey | JOEOHEMWSUHBCP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |