C17H18N6 — CID 19136176
4-N-benzyl-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 19136176) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-N-benzyl-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-benzyl-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19136176 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-N-benzyl-6-(2-phenylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(NCc2ccccc2)ncnc1NNc1ccccc1 |
| InChI | InChI=1S/C17H18N6/c18-15-16(19-11-13-7-3-1-4-8-13)20-12-21-17(15)23-22-14-9-5-2-6-10-14/h1-10,12,22H,11,18H2,(H2,19,20,21,23) |
| InChIKey | BLEQYWQELMSZDK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|