C12H14N4S — CID 130154555
4-N-benzyl-6-methylsulfanylpyrimidine-4,5-diamine (PubChem CID 130154555) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-N-benzyl-6-methylsulfanylpyrimidine-4,5-diamine.
| Compound Name | 4-N-benzyl-6-methylsulfanylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 130154555 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-N-benzyl-6-methylsulfanylpyrimidine-4,5-diamine |
| SMILES | CSc1ncnc(NCc2ccccc2)c1N |
| InChI | InChI=1S/C12H14N4S/c1-17-12-10(13)11(15-8-16-12)14-7-9-5-3-2-4-6-9/h2-6,8H,7,13H2,1H3,(H,14,15,16) |
| InChIKey | BPQODCIXFDXEFM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |