C17H19N7 — CID 19136157
3-[[5-amino-6-(benzylamino)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile (PubChem CID 19136157) has the molecular formula C17H19N7 and a molecular weight of 321.39 g/mol. Its IUPAC name is 3-[[5-amino-6-(benzylamino)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile.
| Compound Name | 3-[[5-amino-6-(benzylamino)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 19136157 |
| Molecular Formula | C17H19N7 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-[[5-amino-6-(benzylamino)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
| SMILES | N#CCCN(CCC#N)c1ncnc(NCc2ccccc2)c1N |
| InChI | InChI=1S/C17H19N7/c18-8-4-10-24(11-5-9-19)17-15(20)16(22-13-23-17)21-12-14-6-2-1-3-7-14/h1-3,6-7,13H,4-5,10-12,20H2,(H,21,22,23) |
| InChIKey | ZEMBZTAECRWUHT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |