C16H18N8 — CID 19141426
3-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile (PubChem CID 19141426) has the molecular formula C16H18N8 and a molecular weight of 322.38 g/mol. Its IUPAC name is 3-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile.
| Compound Name | 3-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 19141426 |
| Molecular Formula | C16H18N8 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3-[[5-amino-6-(2-phenylhydrazinyl)pyrimidin-4-yl]-(2-cyanoethyl)amino]propanenitrile |
| SMILES | N#CCCN(CCC#N)c1ncnc(NNc2ccccc2)c1N |
| InChI | InChI=1S/C16H18N8/c17-8-4-10-24(11-5-9-18)16-14(19)15(20-12-21-16)23-22-13-6-2-1-3-7-13/h1-3,6-7,12,22H,4-5,10-11,19H2,(H,20,21,23) |
| InChIKey | SPHYLXLNABEJLX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|