C17H23N5 — CID 19135747
6-N-benzyl-4-N-cyclohexylpyrimidine-4,5,6-triamine (PubChem CID 19135747) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 6-N-benzyl-4-N-cyclohexylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-benzyl-4-N-cyclohexylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135747 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 6-N-benzyl-4-N-cyclohexylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NCc2ccccc2)ncnc1NC1CCCCC1 |
| InChI | InChI=1S/C17H23N5/c18-15-16(19-11-13-7-3-1-4-8-13)20-12-21-17(15)22-14-9-5-2-6-10-14/h1,3-4,7-8,12,14H,2,5-6,9-11,18H2,(H2,19,20,21,22) |
| InChIKey | XIFFZEHZWOWACV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |