C13H23N5O — CID 19135849
4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrimidine-4,5,6-triamine (PubChem CID 19135849) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135849 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 4-N-cyclohexyl-6-N-(2-methoxyethyl)pyrimidine-4,5,6-triamine |
| SMILES | COCCNc1ncnc(NC2CCCCC2)c1N |
| InChI | InChI=1S/C13H23N5O/c1-19-8-7-15-12-11(14)13(17-9-16-12)18-10-5-3-2-4-6-10/h9-10H,2-8,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | FTPWVXUHVNOMHX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|