C15H18N4O — CID 19152582
4-N-cyclopentyl-6-phenoxypyrimidine-4,5-diamine (PubChem CID 19152582) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-phenoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-cyclopentyl-6-phenoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19152582 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-N-cyclopentyl-6-phenoxypyrimidine-4,5-diamine |
| SMILES | Nc1c(NC2CCCC2)ncnc1Oc1ccccc1 |
| InChI | InChI=1S/C15H18N4O/c16-13-14(19-11-6-4-5-7-11)17-10-18-15(13)20-12-8-2-1-3-9-12/h1-3,8-11H,4-7,16H2,(H,17,18,19) |
| InChIKey | GYDUBWLUHLLVCR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |