C13H22N4O — CID 82455194
4-N-cyclopentyl-6-(2-methylpropoxy)pyrimidine-4,5-diamine (PubChem CID 82455194) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-(2-methylpropoxy)pyrimidine-4,5-diamine.
| Compound Name | 4-N-cyclopentyl-6-(2-methylpropoxy)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82455194 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-N-cyclopentyl-6-(2-methylpropoxy)pyrimidine-4,5-diamine |
| SMILES | CC(C)COc1ncnc(NC2CCCC2)c1N |
| InChI | InChI=1S/C13H22N4O/c1-9(2)7-18-13-11(14)12(15-8-16-13)17-10-5-3-4-6-10/h8-10H,3-7,14H2,1-2H3,(H,15,16,17) |
| InChIKey | DIEFOBYFEPVTFI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |