C16H27N5 — CID 19153951
6-N-cycloheptyl-4-N-cyclopentylpyrimidine-4,5,6-triamine (PubChem CID 19153951) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 6-N-cycloheptyl-4-N-cyclopentylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-cycloheptyl-4-N-cyclopentylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19153951 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 6-N-cycloheptyl-4-N-cyclopentylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(NC2CCCCCC2)ncnc1NC1CCCC1 |
| InChI | InChI=1S/C16H27N5/c17-14-15(20-12-7-3-1-2-4-8-12)18-11-19-16(14)21-13-9-5-6-10-13/h11-13H,1-10,17H2,(H2,18,19,20,21) |
| InChIKey | RLEZZBWBTTZRMU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |